Back to Directory
NEET CHEMISTRYMedium

For the reaction, CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightleftharpoons CO_2(g) + 2H_2O(l), ΔrH=170 kJ mol1\Delta_r H = -170 \text{ kJ mol}^{-1}. Which of the following statements is not true?

A

At equilibrium, the concentrations of CO2(g)CO_2(g) and H2O(l)H_2O(l) are not equal

B

The equilibrium constant for the reaction is given by Kp=[CO2][CH4][O2]K_p = \frac{[CO_2]}{[CH_4][O_2]}

C

Addition of CH4(g)CH_4(g) or O2(g)O_2(g) at equilibrium will cause a shift to the right

D

The reaction is exothermic

Step-by-Step Solution

Let us evaluate all the statements:

  1. The concentration of pure liquid water, H2O(l)H_2O(l), is constant (approx. 55.5 M) and its active mass is taken as unity. It will not be equal to the concentration of CO2(g)CO_2(g). Hence, this statement is true.
  2. The equilibrium constant KpK_p is expressed in terms of partial pressures, not molar concentrations. Also, the stoichiometric coefficient of O2O_2 is 2, so it should be squared. The correct expression is Kp=pCO2pCH4pO22K_p = \frac{p_{CO_2}}{p_{CH_4} \cdot p_{O_2}^2}. Similarly, Kc=[CO2][CH4][O2]2K_c = \frac{[CO_2]}{[CH_4][O_2]^2}. The expression given in the option misses the square on O2O_2 and uses concentration brackets for KpK_p. Thus, this statement is not true.
  3. According to Le Chatelier's principle, adding reactants (CH4CH_4 or O2O_2) to a system at equilibrium will shift the equilibrium in the forward direction (to the right) to consume the added reactants. Thus, this statement is true.
  4. The enthalpy change of the reaction, ΔrH\Delta_r H, is negative (170 kJ mol1-170 \text{ kJ mol}^{-1}), which indicates that heat is released. Thus, the reaction is exothermic. This statement is true.
Practice Mode Available

Master this Topic on Sushrut

Join thousands of students and practice with AI-generated mock tests.

Get Started
Solved: CHEMISTRY Question for NEET | Sushrut