The given sequence of reactions is as follows:
-
Formation of Acid Chloride (B): Propanoic acid (CH3CH2COOH) reacts with thionyl chloride (SOCl2) to form propanoyl chloride (B).
CH3CH2COOH+SOCl2⟶CH3CH2COCl(B)+SO2+HCl
-
Formation of Amide (C): Propanoyl chloride (B) reacts with ammonia (NH3) to undergo nucleophilic acyl substitution, forming propanamide (C).
CH3CH2COCl+2NH3⟶CH3CH2CONH2(C)+NH4Cl
-
Hofmann Bromamide Degradation (D): Propanamide (C) reacts with bromine (Br2) in the presence of a strong base like potassium hydroxide (KOH). This is the Hofmann bromamide degradation reaction, which converts a primary amide to a primary amine with one carbon atom less than the original amide.
CH3CH2CONH2+Br2+4KOH⟶CH3CH2NH2(D)+K2CO3+2KBr+2H2O
Therefore, the final product D is ethanamine (CH3CH2NH2).